About N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide
N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide (PubChem CID 88974746) has the molecular formula C8H19N5O
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide |
| PubChem CID | 88974746 |
| Molecular Formula | C8H19N5O |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide |
| SMILES | CNN(/C=C(\N)CN)CCNC(C)=O |
| InChI | InChI=1S/C8H19N5O/c1-7(14)12-3-4-13(11-2)6-8(10)5-9/h6,11H,3-5,9-10H2,1-2H3,(H,12,14)/b8-6- |
| InChIKey | NHCANYYXCYPHJG-VURMDHGXSA-N |
| XLogP | -1.68 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide?
The IUPAC name of N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide (CID 88974746) is N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide.
What is the SMILES notation for N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide?
The canonical SMILES for N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide is CNN(/C=C(\N)CN)CCNC(C)=O.
What is the InChIKey of N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide?
The InChIKey is NHCANYYXCYPHJG-VURMDHGXSA-N. The full InChI is InChI=1S/C8H19N5O/c1-7(14)12-3-4-13(11-2)6-8(10)5-9/h6,11H,3-5,9-10H2,1-2H3,(H,12,14)/b8-6-.
What are the key properties of N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide?
N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide has a molecular weight of 201.27 g/mol, XLogP of -1.68, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[(Z)-2,3-diaminoprop-1-enyl]-(methylamino)amino]ethyl]acetamide is sourced from PubChem (CID 88974746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).