About 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine
1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine (PubChem CID 88974837) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine |
| PubChem CID | 88974837 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine |
| SMILES | C#CCN(C)C(C)CC1=CCCC=C1 |
| InChI | InChI=1S/C13H19N/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h1,6,8-9,12H,5,7,10-11H2,2-3H3 |
| InChIKey | LYIRBDWMSKCAIH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine (CID 88974837) is 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine is C#CCN(C)C(C)CC1=CCCC=C1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine?
The InChIKey is LYIRBDWMSKCAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h1,6,8-9,12H,5,7,10-11H2,2-3H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine?
1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine has a molecular weight of 189.30 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-N-methyl-N-prop-2-ynylpropan-2-amine is sourced from PubChem (CID 88974837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).