C19H34O2 — CID 88974857
(1R,3aR,4S,7aR)-1-(6-methoxy-6-methylhept-1-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 88974857) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-1-(6-methoxy-6-methylhept-1-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-1-(6-methoxy-6-methylhept-1-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 88974857 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | (1R,3aR,4S,7aR)-1-(6-methoxy-6-methylhept-1-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C=C(CCCC(C)(C)OC)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C19H34O2/c1-14(8-6-12-18(2,3)21-5)15-10-11-16-17(20)9-7-13-19(15,16)4/h15-17,20H,1,6-13H2,2-5H3/t15-,16+,17+,19-/m1/s1 |
| InChIKey | XASZAWSMPCVFBU-VUHPKUFZSA-N |
| XLogP | 4.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|