About (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol
(3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol (PubChem CID 88974920) has the molecular formula C8H13F6NO
and a molecular weight of 253.19 g/mol. Its IUPAC name is (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol.
Molecular Properties
| Compound Name | (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol |
| PubChem CID | 88974920 |
| Molecular Formula | C8H13F6NO |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol |
| SMILES | CC(C)N[C@H](C)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6NO/c1-4(2)15-5(3)6(16,7(9,10)11)8(12,13)14/h4-5,15-16H,1-3H3/t5-/m1/s1 |
| InChIKey | WPZGMFSBSFUZOX-RXMQYKEDSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol?
The IUPAC name of (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol (CID 88974920) is (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol.
What is the SMILES notation for (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol?
The canonical SMILES for (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol is CC(C)N[C@H](C)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol?
The InChIKey is WPZGMFSBSFUZOX-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H13F6NO/c1-4(2)15-5(3)6(16,7(9,10)11)8(12,13)14/h4-5,15-16H,1-3H3/t5-/m1/s1.
What are the key properties of (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol?
(3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol has a molecular weight of 253.19 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,1,1-trifluoro-3-(propan-2-ylamino)-2-(trifluoromethyl)butan-2-ol is sourced from PubChem (CID 88974920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).