About N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine
N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine (PubChem CID 88975148) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine |
| PubChem CID | 88975148 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine |
| SMILES | CCNc1nnc(C)o1 |
| InChI | InChI=1S/C5H9N3O/c1-3-6-5-8-7-4(2)9-5/h3H2,1-2H3,(H,6,8) |
| InChIKey | TUHQVKCLKSHJFU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine?
The IUPAC name of N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine (CID 88975148) is N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine?
The canonical SMILES for N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine is CCNc1nnc(C)o1.
What is the InChIKey of N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine?
The InChIKey is TUHQVKCLKSHJFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-3-6-5-8-7-4(2)9-5/h3H2,1-2H3,(H,6,8).
What are the key properties of N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine?
N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine has a molecular weight of 127.15 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-methyl-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 88975148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).