C22H30N6O4 — CID 88975203
(1-aminoethylideneamino) 4-[[(1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 88975203) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is (1-aminoethylideneamino) 4-[[(1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | (1-aminoethylideneamino) 4-[[(1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 88975203 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (1-aminoethylideneamino) 4-[[(1R,5S)-8-[(2-methylpropan-2-yl)oxycarbonyl]-8-azabicyclo[3.2.1]octan-3-yl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | CC(N)=NOC(=O)c1cnc2[nH]ccc2c1NC1C[C@H]2CC[C@@H](C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N6O4/c1-12(23)27-32-20(29)17-11-25-19-16(7-8-24-19)18(17)26-13-9-14-5-6-15(10-13)28(14)21(30)31-22(2,3)4/h7-8,11,13-15H,5-6,9-10H2,1-4H3,(H2,23,27)(H2,24,25,26)/t13?,14-,15+ |
| InChIKey | YQAODSUJAIXOQT-GOOCMWNKSA-N |
| XLogP | 3.35 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|