About iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate
iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate (PubChem CID 88975332) has the molecular formula C21H17CoN4O-
and a molecular weight of 400.33 g/mol. Its IUPAC name is iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate.
Molecular Properties
| Compound Name | iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate |
| PubChem CID | 88975332 |
| Molecular Formula | C21H17CoN4O- |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate |
| SMILES | N=[Co].[H]/N=C/Oc1ccc(/N=C/c2ccc(/C=N/c3cc[c-]cc3)cc2)cc1 |
| InChI | InChI=1S/C21H16N3O.Co.HN/c22-16-25-21-12-10-20(11-13-21)24-15-18-8-6-17(7-9-18)14-23-19-4-2-1-3-5-19;;/h2-16,22H;;1H/q-1;;/b22-16+,23-14+,24-15+;; |
| InChIKey | NBSMKQPCZZPFKH-MPXKSSFMSA-N |
| XLogP | 5.27 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate?
The IUPAC name of iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate (CID 88975332) is iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate.
What is the SMILES notation for iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate?
The canonical SMILES for iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate is N=[Co].[H]/N=C/Oc1ccc(/N=C/c2ccc(/C=N/c3cc[c-]cc3)cc2)cc1.
What is the InChIKey of iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate?
The InChIKey is NBSMKQPCZZPFKH-MPXKSSFMSA-N. The full InChI is InChI=1S/C21H16N3O.Co.HN/c22-16-25-21-12-10-20(11-13-21)24-15-18-8-6-17(7-9-18)14-23-19-4-2-1-3-5-19;;/h2-16,22H;;1H/q-1;;/b22-16+,23-14+,24-15+;;.
What are the key properties of iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate?
iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate has a molecular weight of 400.33 g/mol, XLogP of 5.27, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for iminocobalt;[4-[[4-(phenyliminomethyl)phenyl]methylideneamino]phenyl] methanimidate is sourced from PubChem (CID 88975332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).