About 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine
1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine (PubChem CID 88975377) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 88975377 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine |
| SMILES | Cc1cn(C)c2nc(N)ccc12 |
| InChI | InChI=1S/C9H11N3/c1-6-5-12(2)9-7(6)3-4-8(10)11-9/h3-5H,1-2H3,(H2,10,11) |
| InChIKey | WYUCWOCUANTYDR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine (CID 88975377) is 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine is Cc1cn(C)c2nc(N)ccc12.
What is the InChIKey of 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is WYUCWOCUANTYDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-6-5-12(2)9-7(6)3-4-8(10)11-9/h3-5H,1-2H3,(H2,10,11).
What are the key properties of 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine?
1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 161.21 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 88975377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).