About N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine
N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine (PubChem CID 88975392) has the molecular formula C14H29F2N
and a molecular weight of 249.39 g/mol. Its IUPAC name is N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine |
| PubChem CID | 88975392 |
| Molecular Formula | C14H29F2N |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine |
| SMILES | CC(F)(F)CCCCC(C)(C)CNC(C)(C)C |
| InChI | InChI=1S/C14H29F2N/c1-12(2,3)17-11-13(4,5)9-7-8-10-14(6,15)16/h17H,7-11H2,1-6H3 |
| InChIKey | JOPXHNKKDDGATH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine?
The IUPAC name of N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine (CID 88975392) is N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine.
What is the SMILES notation for N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine?
The canonical SMILES for N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine is CC(F)(F)CCCCC(C)(C)CNC(C)(C)C.
What is the InChIKey of N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine?
The InChIKey is JOPXHNKKDDGATH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29F2N/c1-12(2,3)17-11-13(4,5)9-7-8-10-14(6,15)16/h17H,7-11H2,1-6H3.
What are the key properties of N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine?
N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine has a molecular weight of 249.39 g/mol, XLogP of 4.62, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-7,7-difluoro-2,2-dimethyloctan-1-amine is sourced from PubChem (CID 88975392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).