C14H27F2N — CID 88975393
(E)-N-tert-butyl-7,7-difluoro-2,2-dimethyloct-5-en-1-amine (PubChem CID 88975393) has the molecular formula C14H27F2N and a molecular weight of 247.37 g/mol. Its IUPAC name is (E)-N-tert-butyl-7,7-difluoro-2,2-dimethyloct-5-en-1-amine.
| Compound Name | (E)-N-tert-butyl-7,7-difluoro-2,2-dimethyloct-5-en-1-amine |
|---|---|
| PubChem CID | 88975393 |
| Molecular Formula | C14H27F2N |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | (E)-N-tert-butyl-7,7-difluoro-2,2-dimethyloct-5-en-1-amine |
| SMILES | CC(F)(F)/C=C/CCC(C)(C)CNC(C)(C)C |
| InChI | InChI=1S/C14H27F2N/c1-12(2,3)17-11-13(4,5)9-7-8-10-14(6,15)16/h8,10,17H,7,9,11H2,1-6H3/b10-8+ |
| InChIKey | BZZYINYKIPNYHA-CSKARUKUSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|