About (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene
(E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene (PubChem CID 88975413) has the molecular formula C12H22F2O2
and a molecular weight of 236.30 g/mol. Its IUPAC name is (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene.
Molecular Properties
| Compound Name | (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene |
| PubChem CID | 88975413 |
| Molecular Formula | C12H22F2O2 |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene |
| SMILES | CCOC(C)C(C)OC/C=C/C(F)(F)CC |
| InChI | InChI=1S/C12H22F2O2/c1-5-12(13,14)8-7-9-16-11(4)10(3)15-6-2/h7-8,10-11H,5-6,9H2,1-4H3/b8-7+ |
| InChIKey | RSUFHMNYRAVELS-BQYQJAHWSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene?
The IUPAC name of (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene (CID 88975413) is (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene.
What is the SMILES notation for (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene?
The canonical SMILES for (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene is CCOC(C)C(C)OC/C=C/C(F)(F)CC.
What is the InChIKey of (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene?
The InChIKey is RSUFHMNYRAVELS-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H22F2O2/c1-5-12(13,14)8-7-9-16-11(4)10(3)15-6-2/h7-8,10-11H,5-6,9H2,1-4H3/b8-7+.
What are the key properties of (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene?
(E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene has a molecular weight of 236.30 g/mol, XLogP of 3.42, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(3-ethoxybutan-2-yloxy)-4,4-difluorohex-2-ene is sourced from PubChem (CID 88975413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).