C9H16N4O5 — CID 88975962
4-amino-1-[1-(2,3-dihydroxy-1-methoxypropoxy)ethyl]-1,3,5-triazin-2-one (PubChem CID 88975962) has the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 4-amino-1-[1-(2,3-dihydroxy-1-methoxypropoxy)ethyl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[1-(2,3-dihydroxy-1-methoxypropoxy)ethyl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 88975962 |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-amino-1-[1-(2,3-dihydroxy-1-methoxypropoxy)ethyl]-1,3,5-triazin-2-one |
| SMILES | COC(OC(C)n1cnc(N)nc1=O)C(O)CO |
| InChI | InChI=1S/C9H16N4O5/c1-5(18-7(17-2)6(15)3-14)13-4-11-8(10)12-9(13)16/h4-7,14-15H,3H2,1-2H3,(H2,10,12,16) |
| InChIKey | BLLSYRWTENQBBF-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|