C24H23F2N5O3 — CID 88976061
(6S)-N-[5-[amino-[(2Z)-penta-2,4-dienoyl]amino]-4-fluoro-2-methylphenyl]-6-(4-fluorophenyl)-3-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 88976061) has the molecular formula C24H23F2N5O3 and a molecular weight of 467.48 g/mol. Its IUPAC name is (6S)-N-[5-[amino-[(2Z)-penta-2,4-dienoyl]amino]-4-fluoro-2-methylphenyl]-6-(4-fluorophenyl)-3-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | (6S)-N-[5-[amino-[(2Z)-penta-2,4-dienoyl]amino]-4-fluoro-2-methylphenyl]-6-(4-fluorophenyl)-3-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 88976061 |
| Molecular Formula | C24H23F2N5O3 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (6S)-N-[5-[amino-[(2Z)-penta-2,4-dienoyl]amino]-4-fluoro-2-methylphenyl]-6-(4-fluorophenyl)-3-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | C=C/C=C\C(=O)N(N)c1cc(NC(=O)C2=CN(C)C(=O)N[C@H]2c2ccc(F)cc2)c(C)cc1F |
| InChI | InChI=1S/C24H23F2N5O3/c1-4-5-6-21(32)31(27)20-12-19(14(2)11-18(20)26)28-23(33)17-13-30(3)24(34)29-22(17)15-7-9-16(25)10-8-15/h4-13,22H,1,27H2,2-3H3,(H,28,33)(H,29,34)/b6-5-/t22-/m0/s1 |
| InChIKey | XCJNQOVPJHZLSA-LXHZQTKUSA-N |
| XLogP | 3.44 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|