C17H26N2O3 — CID 88976145
(2S)-N-[(1Z,4S,6Z)-4-hydroxyocta-1,6-dienyl]-3,3-dimethyl-2-(prop-2-ynoylamino)butanamide (PubChem CID 88976145) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2S)-N-[(1Z,4S,6Z)-4-hydroxyocta-1,6-dienyl]-3,3-dimethyl-2-(prop-2-ynoylamino)butanamide.
| Compound Name | (2S)-N-[(1Z,4S,6Z)-4-hydroxyocta-1,6-dienyl]-3,3-dimethyl-2-(prop-2-ynoylamino)butanamide |
|---|---|
| PubChem CID | 88976145 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2S)-N-[(1Z,4S,6Z)-4-hydroxyocta-1,6-dienyl]-3,3-dimethyl-2-(prop-2-ynoylamino)butanamide |
| SMILES | C#CC(=O)N[C@H](C(=O)N/C=C\C[C@@H](O)C/C=C\C)C(C)(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-6-8-10-13(20)11-9-12-18-16(22)15(17(3,4)5)19-14(21)7-2/h2,6,8-9,12-13,15,20H,10-11H2,1,3-5H3,(H,18,22)(H,19,21)/b8-6-,12-9-/t13-,15+/m0/s1 |
| InChIKey | HEIIVERRVQERNE-DOUQCGBCSA-N |
| XLogP | 1.50 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|