C35H46N2O3Si — CID 88976165
(2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-3,3-dimethyl-2-[[(E)-pent-2-en-4-ynoyl]amino]butanamide (PubChem CID 88976165) has the molecular formula C35H46N2O3Si and a molecular weight of 570.85 g/mol. Its IUPAC name is (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-3,3-dimethyl-2-[[(E)-pent-2-en-4-ynoyl]amino]butanamide.
| Compound Name | (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-3,3-dimethyl-2-[[(E)-pent-2-en-4-ynoyl]amino]butanamide |
|---|---|
| PubChem CID | 88976165 |
| Molecular Formula | C35H46N2O3Si |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-3,3-dimethyl-2-[[(E)-pent-2-en-4-ynoyl]amino]butanamide |
| SMILES | C#C/C=C/C(=O)N[C@H](C(=O)N/C=C\C[C@H](C/C=C\C)CC(C)(C)[Si](O)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H46N2O3Si/c1-8-10-19-28(20-18-26-36-33(39)32(34(3,4)5)37-31(38)25-11-9-2)27-35(6,7)41(40,29-21-14-12-15-22-29)30-23-16-13-17-24-30/h2,8,10-18,21-26,28,32,40H,19-20,27H2,1,3-7H3,(H,36,39)(H,37,38)/b10-8-,25-11+,26-18-/t28-,32+/m0/s1 |
| InChIKey | WYYFCELBDGABSO-RBNMRNJTSA-N |
| XLogP | 5.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|