C28H40ClN3O7 — CID 88976181
[(1Z,4R,6E)-7-chloro-1-[[(2S)-2-[[(2Z,4Z,6S)-6-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]hepta-2,4-dienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 88976181) has the molecular formula C28H40ClN3O7 and a molecular weight of 566.10 g/mol. Its IUPAC name is [(1Z,4R,6E)-7-chloro-1-[[(2S)-2-[[(2Z,4Z,6S)-6-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]hepta-2,4-dienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [(1Z,4R,6E)-7-chloro-1-[[(2S)-2-[[(2Z,4Z,6S)-6-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]hepta-2,4-dienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 88976181 |
| Molecular Formula | C28H40ClN3O7 |
| Molecular Weight | 566.10 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | [(1Z,4R,6E)-7-chloro-1-[[(2S)-2-[[(2Z,4Z,6S)-6-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]hepta-2,4-dienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | COC1=CC[C@@H]([C@@H](C)/C=C\C=C/C(=O)N[C@H](C(=O)N/C=C\C[C@H](C/C=C(\C)Cl)OC(N)=O)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C28H40ClN3O7/c1-18(21-15-16-22(37-6)26(35)39-21)10-7-8-12-23(33)32-24(28(3,4)5)25(34)31-17-9-11-20(38-27(30)36)14-13-19(2)29/h7-10,12-13,16-18,20-21,24H,11,14-15H2,1-6H3,(H2,30,36)(H,31,34)(H,32,33)/b10-7-,12-8-,17-9-,19-13+/t18-,20+,21-,24+/m0/s1 |
| InChIKey | JWTAGGYGJFBGEM-OMZXRMGVSA-N |
| XLogP | 4.13 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.10 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|