C33H45IN2O3Si — CID 88976202
(2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-2-[[(Z)-3-iodoprop-2-enoyl]amino]-3,3-dimethylbutanamide (PubChem CID 88976202) has the molecular formula C33H45IN2O3Si and a molecular weight of 672.72 g/mol. Its IUPAC name is (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-2-[[(Z)-3-iodoprop-2-enoyl]amino]-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-2-[[(Z)-3-iodoprop-2-enoyl]amino]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 88976202 |
| Molecular Formula | C33H45IN2O3Si |
| Molecular Weight | 672.72 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | (2S)-N-[(1Z,4S,6Z)-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]octa-1,6-dienyl]-2-[[(Z)-3-iodoprop-2-enoyl]amino]-3,3-dimethylbutanamide |
| SMILES | C/C=C\C[C@@H](C/C=C\NC(=O)[C@@H](NC(=O)/C=C\I)C(C)(C)C)CC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H45IN2O3Si/c1-7-8-16-26(17-15-24-35-31(38)30(32(2,3)4)36-29(37)22-23-34)25-33(5,6)40(39,27-18-11-9-12-19-27)28-20-13-10-14-21-28/h7-15,18-24,26,30,39H,16-17,25H2,1-6H3,(H,35,38)(H,36,37)/b8-7-,23-22-,24-15-/t26-,30+/m0/s1 |
| InChIKey | WLWFEWJOJPFYHT-GEDVATTKSA-N |
| XLogP | 5.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|