C7H10Br2O3 — CID 88976612
(2R,3R,5S)-2-(2,2-dibromoethenyl)-5-methyloxolane-3,4-diol (PubChem CID 88976612) has the molecular formula C7H10Br2O3 and a molecular weight of 301.96 g/mol. Its IUPAC name is (2R,3R,5S)-2-(2,2-dibromoethenyl)-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,5S)-2-(2,2-dibromoethenyl)-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 88976612 |
| Molecular Formula | C7H10Br2O3 |
| Molecular Weight | 301.96 g/mol |
| Exact Mass | 299.90 |
| IUPAC Name | (2R,3R,5S)-2-(2,2-dibromoethenyl)-5-methyloxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](C=C(Br)Br)[C@H](O)C1O |
| InChI | InChI=1S/C7H10Br2O3/c1-3-6(10)7(11)4(12-3)2-5(8)9/h2-4,6-7,10-11H,1H3/t3-,4+,6?,7-/m0/s1 |
| InChIKey | DZNOPJGIHJLHQQ-UNYIURARSA-N |
| XLogP | 1.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.96 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |