C8H13NO4 — CID 88976631
(4aS,5S,7S)-5-(hydroxymethyl)-7-methyl-3,4,4a,5,7,7a-hexahydrofuro[3,4-e][1,3]oxazin-2-one (PubChem CID 88976631) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is (4aS,5S,7S)-5-(hydroxymethyl)-7-methyl-3,4,4a,5,7,7a-hexahydrofuro[3,4-e][1,3]oxazin-2-one.
| Compound Name | (4aS,5S,7S)-5-(hydroxymethyl)-7-methyl-3,4,4a,5,7,7a-hexahydrofuro[3,4-e][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 88976631 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (4aS,5S,7S)-5-(hydroxymethyl)-7-methyl-3,4,4a,5,7,7a-hexahydrofuro[3,4-e][1,3]oxazin-2-one |
| SMILES | C[C@@H]1O[C@H](CO)[C@@H]2CNC(=O)OC12 |
| InChI | InChI=1S/C8H13NO4/c1-4-7-5(6(3-10)12-4)2-9-8(11)13-7/h4-7,10H,2-3H2,1H3,(H,9,11)/t4-,5-,6+,7?/m0/s1 |
| InChIKey | QKRKPWYFAGRCTK-VNEOENNNSA-N |
| XLogP | -0.51 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |