C9H12O3 — CID 88976647
(2R,3R,5S)-2-[(E)-but-1-en-3-ynyl]-5-methyloxolane-3,4-diol (PubChem CID 88976647) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (2R,3R,5S)-2-[(E)-but-1-en-3-ynyl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,5S)-2-[(E)-but-1-en-3-ynyl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 88976647 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (2R,3R,5S)-2-[(E)-but-1-en-3-ynyl]-5-methyloxolane-3,4-diol |
| SMILES | C#C/C=C/[C@H]1O[C@@H](C)C(O)[C@H]1O |
| InChI | InChI=1S/C9H12O3/c1-3-4-5-7-9(11)8(10)6(2)12-7/h1,4-11H,2H3/b5-4+/t6-,7+,8?,9-/m0/s1 |
| InChIKey | KFRNZHWTJASSKK-JJWQTFPKSA-N |
| XLogP | -0.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|