C12H20O3Si — CID 88976649
(2S,4R,5R)-2-methyl-5-[(E)-4-trimethylsilylbut-1-en-3-ynyl]oxolane-3,4-diol (PubChem CID 88976649) has the molecular formula C12H20O3Si and a molecular weight of 240.37 g/mol. Its IUPAC name is (2S,4R,5R)-2-methyl-5-[(E)-4-trimethylsilylbut-1-en-3-ynyl]oxolane-3,4-diol.
| Compound Name | (2S,4R,5R)-2-methyl-5-[(E)-4-trimethylsilylbut-1-en-3-ynyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 88976649 |
| Molecular Formula | C12H20O3Si |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (2S,4R,5R)-2-methyl-5-[(E)-4-trimethylsilylbut-1-en-3-ynyl]oxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](/C=C/C#C[Si](C)(C)C)[C@H](O)C1O |
| InChI | InChI=1S/C12H20O3Si/c1-9-11(13)12(14)10(15-9)7-5-6-8-16(2,3)4/h5,7,9-14H,1-4H3/b7-5+/t9-,10+,11?,12-/m0/s1 |
| InChIKey | OIYCTKGBXLGQFS-KSWCQLSFSA-N |
| XLogP | 0.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|