About 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine
2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine (PubChem CID 88976714) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine |
| PubChem CID | 88976714 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine |
| SMILES | [H]/N=C(\C=C\C)C1=CC=CCC1N |
| InChI | InChI=1S/C10H14N2/c1-2-5-9(11)8-6-3-4-7-10(8)12/h2-6,10-11H,7,12H2,1H3/b5-2+,11-9+ |
| InChIKey | KIINLRBWWGOMBC-LBPHOODGSA-N |
| XLogP | 1.80 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine?
The IUPAC name of 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine (CID 88976714) is 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine is [H]/N=C(\C=C\C)C1=CC=CCC1N.
What is the InChIKey of 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine?
The InChIKey is KIINLRBWWGOMBC-LBPHOODGSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-5-9(11)8-6-3-4-7-10(8)12/h2-6,10-11H,7,12H2,1H3/b5-2+,11-9+.
What are the key properties of 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine?
2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine has a molecular weight of 162.24 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-but-2-enimidoyl]cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 88976714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).