About 7-methylidene-[1,4]dioxino[2,3-c]pyridazine
7-methylidene-[1,4]dioxino[2,3-c]pyridazine (PubChem CID 88977045) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 7-methylidene-[1,4]dioxino[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 7-methylidene-[1,4]dioxino[2,3-c]pyridazine |
| PubChem CID | 88977045 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 7-methylidene-[1,4]dioxino[2,3-c]pyridazine |
| SMILES | C=C1COc2ccnnc2O1 |
| InChI | InChI=1S/C7H6N2O2/c1-5-4-10-6-2-3-8-9-7(6)11-5/h2-3H,1,4H2 |
| InChIKey | QDCJRAHTVWVOIF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methylidene-[1,4]dioxino[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidene-[1,4]dioxino[2,3-c]pyridazine?
The IUPAC name of 7-methylidene-[1,4]dioxino[2,3-c]pyridazine (CID 88977045) is 7-methylidene-[1,4]dioxino[2,3-c]pyridazine.
What is the SMILES notation for 7-methylidene-[1,4]dioxino[2,3-c]pyridazine?
The canonical SMILES for 7-methylidene-[1,4]dioxino[2,3-c]pyridazine is C=C1COc2ccnnc2O1.
What is the InChIKey of 7-methylidene-[1,4]dioxino[2,3-c]pyridazine?
The InChIKey is QDCJRAHTVWVOIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c1-5-4-10-6-2-3-8-9-7(6)11-5/h2-3H,1,4H2.
What are the key properties of 7-methylidene-[1,4]dioxino[2,3-c]pyridazine?
7-methylidene-[1,4]dioxino[2,3-c]pyridazine has a molecular weight of 150.14 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidene-[1,4]dioxino[2,3-c]pyridazine is sourced from PubChem (CID 88977045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).