C21H33N5O3S — CID 88977448
2-(5-isothiocyanato-2-methoxyphenyl)-2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)acetic acid (PubChem CID 88977448) has the molecular formula C21H33N5O3S and a molecular weight of 435.59 g/mol. Its IUPAC name is 2-(5-isothiocyanato-2-methoxyphenyl)-2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)acetic acid.
| Compound Name | 2-(5-isothiocyanato-2-methoxyphenyl)-2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)acetic acid |
|---|---|
| PubChem CID | 88977448 |
| Molecular Formula | C21H33N5O3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-(5-isothiocyanato-2-methoxyphenyl)-2-(4,7,10-trimethyl-1,4,7,10-tetrazacyclododec-1-yl)acetic acid |
| SMILES | COc1ccc(N=C=S)cc1C(C(=O)O)N1CCN(C)CCN(C)CCN(C)CC1 |
| InChI | InChI=1S/C21H33N5O3S/c1-23-7-9-24(2)11-13-26(14-12-25(3)10-8-23)20(21(27)28)18-15-17(22-16-30)5-6-19(18)29-4/h5-6,15,20H,7-14H2,1-4H3,(H,27,28) |
| InChIKey | XNEBRDCGVOWVCW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|