About 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide
2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide (PubChem CID 88977513) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide |
| PubChem CID | 88977513 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)C1C=CC=CC1 |
| InChI | InChI=1S/C10H16N2/c1-10(2,9(11)12)8-6-4-3-5-7-8/h3-6,8H,7H2,1-2H3,(H3,11,12) |
| InChIKey | MYWJCSIYUZAQEL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide?
The IUPAC name of 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide (CID 88977513) is 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide is [H]/N=C(\N)C(C)(C)C1C=CC=CC1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide?
The InChIKey is MYWJCSIYUZAQEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-10(2,9(11)12)8-6-4-3-5-7-8/h3-6,8H,7H2,1-2H3,(H3,11,12).
What are the key properties of 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide?
2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide has a molecular weight of 164.25 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-yl-2-methylpropanimidamide is sourced from PubChem (CID 88977513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).