About CID 88977898
CID 88977898 (PubChem CID 88977898) has the molecular formula C20H14BFN6O
and a molecular weight of 384.18 g/mol.
Molecular Properties
| Compound Name | CID 88977898 |
| PubChem CID | 88977898 |
| Molecular Formula | C20H14BFN6O |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)c2cc(C(=O)c3cnn(-c4ccc5nc(C)[nH]c5c4)c3N)[nH]c2c1 |
| InChI | InChI=1S/C20H14BFN6O/c1-9-25-15-3-2-11(6-17(15)26-9)28-20(23)13(8-24-28)19(29)18-7-12-14(22)4-10(21)5-16(12)27-18/h2-8,27H,23H2,1H3,(H,25,26) |
| InChIKey | YXRASLHUMNIFGL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88977898 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88977898?
The IUPAC name of CID 88977898 (CID 88977898) is not available.
What is the SMILES notation for CID 88977898?
The canonical SMILES for CID 88977898 is [B]c1cc(F)c2cc(C(=O)c3cnn(-c4ccc5nc(C)[nH]c5c4)c3N)[nH]c2c1.
What is the InChIKey of CID 88977898?
The InChIKey is YXRASLHUMNIFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14BFN6O/c1-9-25-15-3-2-11(6-17(15)26-9)28-20(23)13(8-24-28)19(29)18-7-12-14(22)4-10(21)5-16(12)27-18/h2-8,27H,23H2,1H3,(H,25,26).
What are the key properties of CID 88977898?
CID 88977898 has a molecular weight of 384.18 g/mol, XLogP of 2.28, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88977898 is sourced from PubChem (CID 88977898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).