C17H16F6N6 — CID 88978081
(4R)-4-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)-1-[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-b]pyridazin-6-yl]piperidin-3-amine (PubChem CID 88978081) has the molecular formula C17H16F6N6 and a molecular weight of 418.35 g/mol. Its IUPAC name is (4R)-4-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)-1-[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-b]pyridazin-6-yl]piperidin-3-amine.
| Compound Name | (4R)-4-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)-1-[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-b]pyridazin-6-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 88978081 |
| Molecular Formula | C17H16F6N6 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (4R)-4-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)-1-[2-(trifluoromethyl)-[1,2,4]triazolo[1,5-b]pyridazin-6-yl]piperidin-3-amine |
| SMILES | NC1CN(c2ccc3nc(C(F)(F)F)nn3n2)CC[C@@H]1C1CC(F)=C(F)C=C1F |
| InChI | InChI=1S/C17H16F6N6/c18-10-6-12(20)11(19)5-9(10)8-3-4-28(7-13(8)24)15-2-1-14-25-16(17(21,22)23)27-29(14)26-15/h1-2,6,8-9,13H,3-5,7,24H2/t8-,9?,13?/m1/s1 |
| InChIKey | HTOWQDGZNKTVOC-BGQFSCJGSA-N |
| XLogP | 3.32 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |