C26H39N5O2S2 — CID 88978691
2-N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-2-N-propyl-1-N-[2-(6-sulfanylhexylamino)ethyl]benzene-1,2-dicarboxamide (PubChem CID 88978691) has the molecular formula C26H39N5O2S2 and a molecular weight of 517.77 g/mol. Its IUPAC name is 2-N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-2-N-propyl-1-N-[2-(6-sulfanylhexylamino)ethyl]benzene-1,2-dicarboxamide.
| Compound Name | 2-N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-2-N-propyl-1-N-[2-(6-sulfanylhexylamino)ethyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 88978691 |
| Molecular Formula | C26H39N5O2S2 |
| Molecular Weight | 517.77 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-N-(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-2-N-propyl-1-N-[2-(6-sulfanylhexylamino)ethyl]benzene-1,2-dicarboxamide |
| SMILES | CCCN(C(=O)c1ccccc1C(=O)NCCNCCCCCCS)C1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C26H39N5O2S2/c1-2-16-31(19-11-12-22-23(18-19)35-26(27)30-22)25(33)21-10-6-5-9-20(21)24(32)29-15-14-28-13-7-3-4-8-17-34/h5-6,9-10,19,28,34H,2-4,7-8,11-18H2,1H3,(H2,27,30)(H,29,32) |
| InChIKey | VUZUZTDXUUKRTO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|