C31H34N2O8 — CID 88978783
tert-butyl 4-(5-carbamoyl-4,17,19-trihydroxy-8-methylidene-2,6-dioxo-14-tetracyclo[9.8.0.03,9.013,18]nonadeca-1(19),4,13,15,17-pentaenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 88978783) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is tert-butyl 4-(5-carbamoyl-4,17,19-trihydroxy-8-methylidene-2,6-dioxo-14-tetracyclo[9.8.0.03,9.013,18]nonadeca-1(19),4,13,15,17-pentaenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-carbamoyl-4,17,19-trihydroxy-8-methylidene-2,6-dioxo-14-tetracyclo[9.8.0.03,9.013,18]nonadeca-1(19),4,13,15,17-pentaenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 88978783 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | tert-butyl 4-(5-carbamoyl-4,17,19-trihydroxy-8-methylidene-2,6-dioxo-14-tetracyclo[9.8.0.03,9.013,18]nonadeca-1(19),4,13,15,17-pentaenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=C1CC(=O)C(C(N)=O)=C(O)C2C(=O)C3=C(O)c4c(O)ccc(C5=CCN(C(=O)OC(C)(C)C)CC5)c4CC3CC12 |
| InChI | InChI=1S/C31H34N2O8/c1-14-11-21(35)25(29(32)39)28(38)24-18(14)12-16-13-19-17(5-6-20(34)23(19)26(36)22(16)27(24)37)15-7-9-33(10-8-15)30(40)41-31(2,3)4/h5-7,16,18,24,34,36,38H,1,8-13H2,2-4H3,(H2,32,39) |
| InChIKey | CEGCJVLPQOSOHJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|