C32H37F3O7S2Si — CID 88979148
[(3S,4R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-methylsulfanyl-3-(trifluoromethylsulfonyloxy)oxan-4-yl] benzoate (PubChem CID 88979148) has the molecular formula C32H37F3O7S2Si and a molecular weight of 682.86 g/mol. Its IUPAC name is [(3S,4R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-methylsulfanyl-3-(trifluoromethylsulfonyloxy)oxan-4-yl] benzoate.
| Compound Name | [(3S,4R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-methylsulfanyl-3-(trifluoromethylsulfonyloxy)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 88979148 |
| Molecular Formula | C32H37F3O7S2Si |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | [(3S,4R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-6-methylsulfanyl-3-(trifluoromethylsulfonyloxy)oxan-4-yl] benzoate |
| SMILES | CS[C@@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OS(=O)(=O)C(F)(F)F)[C@H](OC(=O)c2ccccc2)C1C |
| InChI | InChI=1S/C32H37F3O7S2Si/c1-22-27(41-29(36)23-15-9-6-10-16-23)28(42-44(37,38)32(33,34)35)26(40-30(22)43-5)21-39-45(31(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,22,26-28,30H,21H2,1-5H3/t22?,26?,27-,28-,30+/m1/s1 |
| InChIKey | ZOAOEKLIKVZCQO-NBBUUQDJSA-N |
| XLogP | 5.75 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|