C25H32N2O — CID 88979595
4-[3-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]-4-methoxyphenyl]aniline (PubChem CID 88979595) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is 4-[3-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]-4-methoxyphenyl]aniline.
| Compound Name | 4-[3-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]-4-methoxyphenyl]aniline |
|---|---|
| PubChem CID | 88979595 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 4-[3-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperidin-4-yl]-4-methoxyphenyl]aniline |
| SMILES | COc1ccc(-c2ccc(N)cc2)cc1C1CCN([C@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C25H32N2O/c1-28-25-9-6-20(18-4-7-22(26)8-5-18)16-23(25)19-10-12-27(13-11-19)24-15-17-2-3-21(24)14-17/h4-9,16-17,19,21,24H,2-3,10-15,26H2,1H3/t17-,21-,24-/m0/s1 |
| InChIKey | OPVRLEZRQUGIEU-JBUDQFAYSA-N |
| XLogP | 5.31 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|