About 1,4-diethyl-3,4-dihydropyridin-2-one
1,4-diethyl-3,4-dihydropyridin-2-one (PubChem CID 88979633) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 1,4-diethyl-3,4-dihydropyridin-2-one.
Molecular Properties
| Compound Name | 1,4-diethyl-3,4-dihydropyridin-2-one |
| PubChem CID | 88979633 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1,4-diethyl-3,4-dihydropyridin-2-one |
| SMILES | CCC1C=CN(CC)C(=O)C1 |
| InChI | InChI=1S/C9H15NO/c1-3-8-5-6-10(4-2)9(11)7-8/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | ZCVIWSZXTJGFHY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-diethyl-3,4-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diethyl-3,4-dihydropyridin-2-one?
The IUPAC name of 1,4-diethyl-3,4-dihydropyridin-2-one (CID 88979633) is 1,4-diethyl-3,4-dihydropyridin-2-one.
What is the SMILES notation for 1,4-diethyl-3,4-dihydropyridin-2-one?
The canonical SMILES for 1,4-diethyl-3,4-dihydropyridin-2-one is CCC1C=CN(CC)C(=O)C1.
What is the InChIKey of 1,4-diethyl-3,4-dihydropyridin-2-one?
The InChIKey is ZCVIWSZXTJGFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-3-8-5-6-10(4-2)9(11)7-8/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 1,4-diethyl-3,4-dihydropyridin-2-one?
1,4-diethyl-3,4-dihydropyridin-2-one has a molecular weight of 153.22 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diethyl-3,4-dihydropyridin-2-one is sourced from PubChem (CID 88979633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).