About N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide
N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 88979793) has the molecular formula C12H10N4O2S
and a molecular weight of 274.31 g/mol. Its IUPAC name is N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 88979793 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(-c2ccc3oc(N)nc3c2)s1 |
| InChI | InChI=1S/C12H10N4O2S/c1-6(17)15-12-14-5-10(19-12)7-2-3-9-8(4-7)16-11(13)18-9/h2-5H,1H3,(H2,13,16)(H,14,15,17) |
| InChIKey | FKKXHWAAZRCNJT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide (CID 88979793) is N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1ncc(-c2ccc3oc(N)nc3c2)s1.
What is the InChIKey of N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is FKKXHWAAZRCNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2S/c1-6(17)15-12-14-5-10(19-12)7-2-3-9-8(4-7)16-11(13)18-9/h2-5H,1H3,(H2,13,16)(H,14,15,17).
What are the key properties of N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide?
N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 274.31 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-amino-1,3-benzoxazol-5-yl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 88979793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).