C21H29FN2 — CID 88979905
5-fluoro-1'-(3-methyl-6-methylidenecycloheptyl)spiro[1,2-dihydroindole-3,4'-piperidine] (PubChem CID 88979905) has the molecular formula C21H29FN2 and a molecular weight of 328.48 g/mol. Its IUPAC name is 5-fluoro-1'-(3-methyl-6-methylidenecycloheptyl)spiro[1,2-dihydroindole-3,4'-piperidine].
| Compound Name | 5-fluoro-1'-(3-methyl-6-methylidenecycloheptyl)spiro[1,2-dihydroindole-3,4'-piperidine] |
|---|---|
| PubChem CID | 88979905 |
| Molecular Formula | C21H29FN2 |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 5-fluoro-1'-(3-methyl-6-methylidenecycloheptyl)spiro[1,2-dihydroindole-3,4'-piperidine] |
| SMILES | C=C1CCC(C)CC(N2CCC3(CC2)CNc2ccc(F)cc23)C1 |
| InChI | InChI=1S/C21H29FN2/c1-15-3-4-16(2)12-18(11-15)24-9-7-21(8-10-24)14-23-20-6-5-17(22)13-19(20)21/h5-6,13,16,18,23H,1,3-4,7-12,14H2,2H3 |
| InChIKey | XTQQXHUXEDCFRN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|