C13H16O2S2 — CID 88980091
(2R,5S)-3-(1,3-benzodithiol-2-yloxy)-2,5-dimethyloxolane (PubChem CID 88980091) has the molecular formula C13H16O2S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2R,5S)-3-(1,3-benzodithiol-2-yloxy)-2,5-dimethyloxolane.
| Compound Name | (2R,5S)-3-(1,3-benzodithiol-2-yloxy)-2,5-dimethyloxolane |
|---|---|
| PubChem CID | 88980091 |
| Molecular Formula | C13H16O2S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (2R,5S)-3-(1,3-benzodithiol-2-yloxy)-2,5-dimethyloxolane |
| SMILES | C[C@H]1CC(OC2Sc3ccccc3S2)[C@@H](C)O1 |
| InChI | InChI=1S/C13H16O2S2/c1-8-7-10(9(2)14-8)15-13-16-11-5-3-4-6-12(11)17-13/h3-6,8-10,13H,7H2,1-2H3/t8-,9+,10?/m0/s1 |
| InChIKey | RSHMYYBGYQGQAU-QIIDTADFSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |