C35H39B2NO4 — CID 88980098
12-propan-2-yl-9,15-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-12-azahexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(13),2(11),3(8),4,6,9,14,16(21),17,19-decaene (PubChem CID 88980098) has the molecular formula C35H39B2NO4 and a molecular weight of 559.32 g/mol. Its IUPAC name is 12-propan-2-yl-9,15-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-12-azahexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(13),2(11),3(8),4,6,9,14,16(21),17,19-decaene.
| Compound Name | 12-propan-2-yl-9,15-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-12-azahexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(13),2(11),3(8),4,6,9,14,16(21),17,19-decaene |
|---|---|
| PubChem CID | 88980098 |
| Molecular Formula | C35H39B2NO4 |
| Molecular Weight | 559.32 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 12-propan-2-yl-9,15-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-12-azahexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(13),2(11),3(8),4,6,9,14,16(21),17,19-decaene |
| SMILES | CC(C)n1c2cc(B3OC(C)(C)C(C)(C)O3)c3cccc4c5cccc6c(B7OC(C)(C)C(C)(C)O7)cc1c(c65)c2c34 |
| InChI | InChI=1S/C35H39B2NO4/c1-19(2)38-26-17-24(36-39-32(3,4)33(5,6)40-36)22-15-11-13-20-21-14-12-16-23-25(37-41-34(7,8)35(9,10)42-37)18-27(38)31(29(21)23)30(26)28(20)22/h11-19H,1-10H3 |
| InChIKey | NYWQXYZATHOYTI-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.32 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|