About hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium
hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium (PubChem CID 88980248) has the molecular formula C9H18O3P+
and a molecular weight of 205.21 g/mol. Its IUPAC name is hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium.
Molecular Properties
| Compound Name | hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium |
| PubChem CID | 88980248 |
| Molecular Formula | C9H18O3P+ |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium |
| SMILES | CC(C)=CC(O[P+](=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H17O3P/c1-7(2)6-8(9(3,4)5)12-13(10)11/h6,8H,1-5H3/p+1 |
| InChIKey | MNEIEULRVPUMLA-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium?
The IUPAC name of hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium (CID 88980248) is hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium.
What is the SMILES notation for hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium?
The canonical SMILES for hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium is CC(C)=CC(O[P+](=O)O)C(C)(C)C.
What is the InChIKey of hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium?
The InChIKey is MNEIEULRVPUMLA-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H17O3P/c1-7(2)6-8(9(3,4)5)12-13(10)11/h6,8H,1-5H3/p+1.
What are the key properties of hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium?
hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium has a molecular weight of 205.21 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-(2,2,5-trimethylhex-4-en-3-yloxy)phosphanium is sourced from PubChem (CID 88980248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).