C22H41N5O5S — CID 88980349
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 88980349) has the molecular formula C22H41N5O5S and a molecular weight of 487.67 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 88980349 |
| Molecular Formula | C22H41N5O5S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCOCCN1CCNCC1 |
| InChI | InChI=1S/C22H41N5O5S/c28-20(4-2-1-3-19-21-18(17-33-19)25-22(29)26-21)24-7-11-30-13-15-32-16-14-31-12-10-27-8-5-23-6-9-27/h18-19,21,23H,1-17H2,(H,24,28)(H2,25,26,29) |
| InChIKey | RBVKGPWZVYPJAD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|