C19H24N2O6 — CID 88980383
(4S)-4-(dimethylamino)-1,1,3,8-tetrahydroxy-6,7-dimethylidene-9-oxo-4,4a,5,9a,10,10a-hexahydroanthracene-2-carboxamide (PubChem CID 88980383) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is (4S)-4-(dimethylamino)-1,1,3,8-tetrahydroxy-6,7-dimethylidene-9-oxo-4,4a,5,9a,10,10a-hexahydroanthracene-2-carboxamide.
| Compound Name | (4S)-4-(dimethylamino)-1,1,3,8-tetrahydroxy-6,7-dimethylidene-9-oxo-4,4a,5,9a,10,10a-hexahydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 88980383 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (4S)-4-(dimethylamino)-1,1,3,8-tetrahydroxy-6,7-dimethylidene-9-oxo-4,4a,5,9a,10,10a-hexahydroanthracene-2-carboxamide |
| SMILES | C=C1CC2CC3C(C(=O)C2=C(O)C1=C)C(O)(O)C(C(N)=O)=C(O)[C@H]3N(C)C |
| InChI | InChI=1S/C19H24N2O6/c1-7-5-9-6-10-12(16(23)11(9)15(22)8(7)2)19(26,27)13(18(20)25)17(24)14(10)21(3)4/h9-10,12,14,22,24,26-27H,1-2,5-6H2,3-4H3,(H2,20,25)/t9?,10?,12?,14-/m0/s1 |
| InChIKey | JLPVLCBUZCRHPF-FGFFJQAFSA-N |
| XLogP | 0.06 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|