C13H19NO — CID 88980385
(E)-N-(2,2-dimethylpropoxy)-1-phenylethanimine (PubChem CID 88980385) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (E)-N-(2,2-dimethylpropoxy)-1-phenylethanimine.
| Compound Name | (E)-N-(2,2-dimethylpropoxy)-1-phenylethanimine |
|---|---|
| PubChem CID | 88980385 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (E)-N-(2,2-dimethylpropoxy)-1-phenylethanimine |
| SMILES | C/C(=N\OCC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H19NO/c1-11(12-8-6-5-7-9-12)14-15-10-13(2,3)4/h5-9H,10H2,1-4H3/b14-11+ |
| InChIKey | NJSHTWBWOUHVOT-SDNWHVSQSA-N |
| XLogP | 3.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|