About N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide
N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide (PubChem CID 88980879) has the molecular formula C13H29NO4S
and a molecular weight of 295.45 g/mol. Its IUPAC name is N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide |
| PubChem CID | 88980879 |
| Molecular Formula | C13H29NO4S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide |
| SMILES | CC(OC(O)CN(C(C)(C)C)S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C13H29NO4S/c1-10(12(2,3)4)18-11(15)9-14(13(5,6)7)19(8,16)17/h10-11,15H,9H2,1-8H3 |
| InChIKey | VGDOOANFSICGDD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide?
The IUPAC name of N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide (CID 88980879) is N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide.
What is the SMILES notation for N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide?
The canonical SMILES for N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide is CC(OC(O)CN(C(C)(C)C)S(C)(=O)=O)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide?
The InChIKey is VGDOOANFSICGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO4S/c1-10(12(2,3)4)18-11(15)9-14(13(5,6)7)19(8,16)17/h10-11,15H,9H2,1-8H3.
What are the key properties of N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide?
N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide has a molecular weight of 295.45 g/mol, XLogP of 1.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-hydroxyethyl]methanesulfonamide is sourced from PubChem (CID 88980879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).