About 4-amino-7,7,7-trifluoro-2-methylheptan-3-one
4-amino-7,7,7-trifluoro-2-methylheptan-3-one (PubChem CID 88980978) has the molecular formula C8H14F3NO
and a molecular weight of 197.20 g/mol. Its IUPAC name is 4-amino-7,7,7-trifluoro-2-methylheptan-3-one.
Molecular Properties
| Compound Name | 4-amino-7,7,7-trifluoro-2-methylheptan-3-one |
| PubChem CID | 88980978 |
| Molecular Formula | C8H14F3NO |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-amino-7,7,7-trifluoro-2-methylheptan-3-one |
| SMILES | CC(C)C(=O)C(N)CCC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO/c1-5(2)7(13)6(12)3-4-8(9,10)11/h5-6H,3-4,12H2,1-2H3 |
| InChIKey | BHPOMKMQWIODAB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-7,7,7-trifluoro-2-methylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-7,7,7-trifluoro-2-methylheptan-3-one?
The IUPAC name of 4-amino-7,7,7-trifluoro-2-methylheptan-3-one (CID 88980978) is 4-amino-7,7,7-trifluoro-2-methylheptan-3-one.
What is the SMILES notation for 4-amino-7,7,7-trifluoro-2-methylheptan-3-one?
The canonical SMILES for 4-amino-7,7,7-trifluoro-2-methylheptan-3-one is CC(C)C(=O)C(N)CCC(F)(F)F.
What is the InChIKey of 4-amino-7,7,7-trifluoro-2-methylheptan-3-one?
The InChIKey is BHPOMKMQWIODAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO/c1-5(2)7(13)6(12)3-4-8(9,10)11/h5-6H,3-4,12H2,1-2H3.
What are the key properties of 4-amino-7,7,7-trifluoro-2-methylheptan-3-one?
4-amino-7,7,7-trifluoro-2-methylheptan-3-one has a molecular weight of 197.20 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-7,7,7-trifluoro-2-methylheptan-3-one is sourced from PubChem (CID 88980978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).