About N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide
N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide (PubChem CID 88980980) has the molecular formula C14H31NO4S
and a molecular weight of 309.47 g/mol. Its IUPAC name is N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide |
| PubChem CID | 88980980 |
| Molecular Formula | C14H31NO4S |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide |
| SMILES | COC(CN(C(C)(C)C)S(C)(=O)=O)OC(C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO4S/c1-11(13(2,3)4)19-12(18-8)10-15(14(5,6)7)20(9,16)17/h11-12H,10H2,1-9H3 |
| InChIKey | MLPOSKMSUHJQTJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide?
The IUPAC name of N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide (CID 88980980) is N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide.
What is the SMILES notation for N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide?
The canonical SMILES for N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide is COC(CN(C(C)(C)C)S(C)(=O)=O)OC(C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide?
The InChIKey is MLPOSKMSUHJQTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO4S/c1-11(13(2,3)4)19-12(18-8)10-15(14(5,6)7)20(9,16)17/h11-12H,10H2,1-9H3.
What are the key properties of N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide?
N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide has a molecular weight of 309.47 g/mol, XLogP of 2.47, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]methanesulfonamide is sourced from PubChem (CID 88980980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).