C17H37NO5S — CID 88980982
N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-3-(2-methoxyethoxy)propyl]methanesulfonamide (PubChem CID 88980982) has the molecular formula C17H37NO5S and a molecular weight of 367.55 g/mol. Its IUPAC name is N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-3-(2-methoxyethoxy)propyl]methanesulfonamide.
| Compound Name | N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-3-(2-methoxyethoxy)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 88980982 |
| Molecular Formula | C17H37NO5S |
| Molecular Weight | 367.55 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-tert-butyl-N-[2-(3,3-dimethylbutan-2-yloxy)-3-(2-methoxyethoxy)propyl]methanesulfonamide |
| SMILES | COCCOCC(CN(C(C)(C)C)S(C)(=O)=O)OC(C)C(C)(C)C |
| InChI | InChI=1S/C17H37NO5S/c1-14(16(2,3)4)23-15(13-22-11-10-21-8)12-18(17(5,6)7)24(9,19)20/h14-15H,10-13H2,1-9H3 |
| InChIKey | KCSZFODQSURTAT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|