About 2-methoxysulfonylethyl cyclohexanecarboxylate
2-methoxysulfonylethyl cyclohexanecarboxylate (PubChem CID 88981060) has the molecular formula C10H18O5S
and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-methoxysulfonylethyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | 2-methoxysulfonylethyl cyclohexanecarboxylate |
| PubChem CID | 88981060 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-methoxysulfonylethyl cyclohexanecarboxylate |
| SMILES | COS(=O)(=O)CCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C10H18O5S/c1-14-16(12,13)8-7-15-10(11)9-5-3-2-4-6-9/h9H,2-8H2,1H3 |
| InChIKey | WSUHAYYPOAULIR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxysulfonylethyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxysulfonylethyl cyclohexanecarboxylate?
The IUPAC name of 2-methoxysulfonylethyl cyclohexanecarboxylate (CID 88981060) is 2-methoxysulfonylethyl cyclohexanecarboxylate.
What is the SMILES notation for 2-methoxysulfonylethyl cyclohexanecarboxylate?
The canonical SMILES for 2-methoxysulfonylethyl cyclohexanecarboxylate is COS(=O)(=O)CCOC(=O)C1CCCCC1.
What is the InChIKey of 2-methoxysulfonylethyl cyclohexanecarboxylate?
The InChIKey is WSUHAYYPOAULIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5S/c1-14-16(12,13)8-7-15-10(11)9-5-3-2-4-6-9/h9H,2-8H2,1H3.
What are the key properties of 2-methoxysulfonylethyl cyclohexanecarboxylate?
2-methoxysulfonylethyl cyclohexanecarboxylate has a molecular weight of 250.32 g/mol, XLogP of 1.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxysulfonylethyl cyclohexanecarboxylate is sourced from PubChem (CID 88981060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).