C11H20O6S — CID 88981070
2-methoxysulfonylethyl 4-(hydroxymethyl)cyclohexane-1-carboxylate (PubChem CID 88981070) has the molecular formula C11H20O6S and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-methoxysulfonylethyl 4-(hydroxymethyl)cyclohexane-1-carboxylate.
| Compound Name | 2-methoxysulfonylethyl 4-(hydroxymethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88981070 |
| Molecular Formula | C11H20O6S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-methoxysulfonylethyl 4-(hydroxymethyl)cyclohexane-1-carboxylate |
| SMILES | COS(=O)(=O)CCOC(=O)C1CCC(CO)CC1 |
| InChI | InChI=1S/C11H20O6S/c1-16-18(14,15)7-6-17-11(13)10-4-2-9(8-12)3-5-10/h9-10,12H,2-8H2,1H3 |
| InChIKey | QPKFLLQTNNSYLM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|