C61H60F6N2S2 — CID 88981098
5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-bis[4-(trifluoromethyl)phenyl]quinoxaline (PubChem CID 88981098) has the molecular formula C61H60F6N2S2 and a molecular weight of 999.29 g/mol. Its IUPAC name is 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-bis[4-(trifluoromethyl)phenyl]quinoxaline.
| Compound Name | 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-bis[4-(trifluoromethyl)phenyl]quinoxaline |
|---|---|
| PubChem CID | 88981098 |
| Molecular Formula | C61H60F6N2S2 |
| Molecular Weight | 999.29 g/mol |
| Exact Mass | 998.41 |
| IUPAC Name | 5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-bis[4-(trifluoromethyl)phenyl]quinoxaline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5nc(-c6ccc(C(F)(F)F)cc6)c(-c6ccc(C(F)(F)F)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C61H60F6N2S2/c1-5-7-9-11-13-15-35-59(36-16-14-12-10-8-6-2)50-37-39(3)17-28-46(50)47-29-23-43(38-51(47)59)52-33-34-54(71-52)49-31-30-48(53-32-18-40(4)70-53)57-58(49)69-56(42-21-26-45(27-22-42)61(65,66)67)55(68-57)41-19-24-44(25-20-41)60(62,63)64/h17-34,37-38H,5-16,35-36H2,1-4H3 |
| InChIKey | UHTPXDVDPHVZCW-UHFFFAOYSA-N |
| XLogP | 20.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.29 |
| LogP ≤ 5 | 20.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|