C15H28NO6+ — CID 88981219
3-[3-acetyloxy-2-(acetyloxymethyl)-2-methylpropanoyl]oxypropyl-trimethylazanium (PubChem CID 88981219) has the molecular formula C15H28NO6+ and a molecular weight of 318.39 g/mol. Its IUPAC name is 3-[3-acetyloxy-2-(acetyloxymethyl)-2-methylpropanoyl]oxypropyl-trimethylazanium.
| Compound Name | 3-[3-acetyloxy-2-(acetyloxymethyl)-2-methylpropanoyl]oxypropyl-trimethylazanium |
|---|---|
| PubChem CID | 88981219 |
| Molecular Formula | C15H28NO6+ |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 3-[3-acetyloxy-2-(acetyloxymethyl)-2-methylpropanoyl]oxypropyl-trimethylazanium |
| SMILES | CC(=O)OCC(C)(COC(C)=O)C(=O)OCCC[N+](C)(C)C |
| InChI | InChI=1S/C15H28NO6/c1-12(17)21-10-15(3,11-22-13(2)18)14(19)20-9-7-8-16(4,5)6/h7-11H2,1-6H3/q+1 |
| InChIKey | NQKHJHJIPLKTHF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|