C20H25F11O2 — CID 88981350
2,2,3,3,6,6,7,7,10,10,10-undecafluorodecyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 88981350) has the molecular formula C20H25F11O2 and a molecular weight of 506.40 g/mol. Its IUPAC name is 2,2,3,3,6,6,7,7,10,10,10-undecafluorodecyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2,2,3,3,6,6,7,7,10,10,10-undecafluorodecyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88981350 |
| Molecular Formula | C20H25F11O2 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 2,2,3,3,6,6,7,7,10,10,10-undecafluorodecyl 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)CCC(F)(F)F)C(C2)C1C |
| InChI | InChI=1S/C20H25F11O2/c1-10-11(2)13-7-12(10)8-14(13)15(32)33-9-19(27,28)18(25,26)4-3-16(21,22)17(23,24)5-6-20(29,30)31/h10-14H,3-9H2,1-2H3 |
| InChIKey | RHDLTPRUKYDWLA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|