C17H19F9O2 — CID 88981354
2,2,3,3,6,6,7,7,7-nonafluoroheptyl 3,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate (PubChem CID 88981354) has the molecular formula C17H19F9O2 and a molecular weight of 426.32 g/mol. Its IUPAC name is 2,2,3,3,6,6,7,7,7-nonafluoroheptyl 3,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate.
| Compound Name | 2,2,3,3,6,6,7,7,7-nonafluoroheptyl 3,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate |
|---|---|
| PubChem CID | 88981354 |
| Molecular Formula | C17H19F9O2 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2,2,3,3,6,6,7,7,7-nonafluoroheptyl 3,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carboxylate |
| SMILES | CC1C2CC3C1C3(C(=O)OCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)F)C2C |
| InChI | InChI=1S/C17H19F9O2/c1-7-9-5-10-11(7)16(10,8(9)2)12(27)28-6-15(22,23)13(18,19)3-4-14(20,21)17(24,25)26/h7-11H,3-6H2,1-2H3 |
| InChIKey | WXJYQTOMUJHZLS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|